C13H16N2O4S — CID 19261658
3-(1,3-dioxoisoindol-2-yl)-N,N-dimethylpropane-1-sulfonamide (PubChem CID 19261658) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 19261658 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H16N2O4S/c1-14(2)20(18,19)9-5-8-15-12(16)10-6-3-4-7-11(10)13(15)17/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | ISKYZRBROBBVPM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|