C9H10O3 — CID 10678634
(1R,2S,4S,5R,7R,9R)-3,6-dioxatetracyclo[7.2.0.02,4.05,7]undecan-10-one (PubChem CID 10678634) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1R,2S,4S,5R,7R,9R)-3,6-dioxatetracyclo[7.2.0.02,4.05,7]undecan-10-one.
| Compound Name | (1R,2S,4S,5R,7R,9R)-3,6-dioxatetracyclo[7.2.0.02,4.05,7]undecan-10-one |
|---|---|
| PubChem CID | 10678634 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (1R,2S,4S,5R,7R,9R)-3,6-dioxatetracyclo[7.2.0.02,4.05,7]undecan-10-one |
| SMILES | O=C1C[C@H]2[C@@H]3O[C@@H]3[C@@H]3O[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C9H10O3/c10-5-1-4-3(5)2-6-8(11-6)9-7(4)12-9/h3-4,6-9H,1-2H2/t3-,4-,6-,7+,8-,9+/m1/s1 |
| InChIKey | ABLDSIXZBDXYAF-DTZILCLSSA-N |
| XLogP | 0.13 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|