C8H8O2 — CID 130834071
(1R,2S,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-3-one (PubChem CID 130834071) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is (1R,2S,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-3-one.
| Compound Name | (1R,2S,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-3-one |
|---|---|
| PubChem CID | 130834071 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (1R,2S,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-3-one |
| SMILES | O=C1C[C@@H]2[C@H]1[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C8H8O2/c9-5-3-4-6-1-2-7(10-6)8(4)5/h1-2,4,6-8H,3H2/t4-,6-,7+,8+/m0/s1 |
| InChIKey | MNAGZKSZJTWUPV-ZAKLUEHWSA-N |
| XLogP | 0.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|