C12H14N2O4 — CID 110191474
(3aS,4R,7S,7aR)-2-morpholin-4-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 110191474) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-morpholin-4-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-morpholin-4-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 110191474 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-morpholin-4-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N1CCOCC1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C12H14N2O4/c15-11-9-7-1-2-8(18-7)10(9)12(16)14(11)13-3-5-17-6-4-13/h1-2,7-10H,3-6H2/t7-,8+,9-,10+ |
| InChIKey | GXUHHKPPQKSYRX-YNFQOJQRSA-N |
| XLogP | -0.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|