C12H12O2 — CID 98557587
(1R,4R,5S,8S,9S,12R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-2,7-dione (PubChem CID 98557587) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (1R,4R,5S,8S,9S,12R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-2,7-dione.
| Compound Name | (1R,4R,5S,8S,9S,12R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-2,7-dione |
|---|---|
| PubChem CID | 98557587 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (1R,4R,5S,8S,9S,12R)-tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-2,7-dione |
| SMILES | O=C1C[C@H]2[C@H]3C=C[C@H]4[C@H]2CC(=O)[C@@H]4[C@H]13 |
| InChI | InChI=1S/C12H12O2/c13-9-3-7-5-1-2-6-8(7)4-10(14)12(6)11(5)9/h1-2,5-8,11-12H,3-4H2/t5-,6+,7+,8-,11+,12- |
| InChIKey | FWEOTUVCRKMCLO-IRHARMPHSA-N |
| XLogP | 1.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|