C8H8O — CID 131138904
(1S,2R,5R,7S)-tricyclo[3.2.1.02,7]oct-3-en-6-one (PubChem CID 131138904) has the molecular formula C8H8O and a molecular weight of 120.15 g/mol. Its IUPAC name is (1S,2R,5R,7S)-tricyclo[3.2.1.02,7]oct-3-en-6-one.
| Compound Name | (1S,2R,5R,7S)-tricyclo[3.2.1.02,7]oct-3-en-6-one |
|---|---|
| PubChem CID | 131138904 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | (1S,2R,5R,7S)-tricyclo[3.2.1.02,7]oct-3-en-6-one |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@H]1C[C@@H]32 |
| InChI | InChI=1S/C8H8O/c9-8-4-1-2-5-6(3-4)7(5)8/h1-2,4-7H,3H2/t4-,5+,6-,7+/m0/s1 |
| InChIKey | JMOCWSNJQORWOT-BNHYGAARSA-N |
| XLogP | 1.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|