C12H10O2 — CID 124536586
(1S,2R,3S,6S,7S,8S,10S,11S)-pentacyclo[6.4.0.02,7.03,11.06,10]dodec-4-ene-9,12-dione (PubChem CID 124536586) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S,2R,3S,6S,7S,8S,10S,11S)-pentacyclo[6.4.0.02,7.03,11.06,10]dodec-4-ene-9,12-dione.
| Compound Name | (1S,2R,3S,6S,7S,8S,10S,11S)-pentacyclo[6.4.0.02,7.03,11.06,10]dodec-4-ene-9,12-dione |
|---|---|
| PubChem CID | 124536586 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1S,2R,3S,6S,7S,8S,10S,11S)-pentacyclo[6.4.0.02,7.03,11.06,10]dodec-4-ene-9,12-dione |
| SMILES | O=C1[C@@H]2[C@H]3C(=O)[C@H]4[C@H]5C=C[C@H]([C@H]14)[C@H]2[C@@H]53 |
| InChI | InChI=1S/C12H10O2/c13-11-7-3-1-2-4-6-5(3)9(11)10(6)12(14)8(4)7/h1-10H/t3-,4-,5-,6+,7-,8-,9-,10-/m0/s1 |
| InChIKey | QRAUHJYDFILDKP-ZILBRMDCSA-N |
| XLogP | 0.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|