C15H14O2 — CID 125033386
(1R,2R,3S,5S,6R,9S,10R,13S,14S,15S)-hexacyclo[7.5.1.02,5.03,13.06,15.010,14]pentadec-11-ene-4,8-dione (PubChem CID 125033386) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1R,2R,3S,5S,6R,9S,10R,13S,14S,15S)-hexacyclo[7.5.1.02,5.03,13.06,15.010,14]pentadec-11-ene-4,8-dione.
| Compound Name | (1R,2R,3S,5S,6R,9S,10R,13S,14S,15S)-hexacyclo[7.5.1.02,5.03,13.06,15.010,14]pentadec-11-ene-4,8-dione |
|---|---|
| PubChem CID | 125033386 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (1R,2R,3S,5S,6R,9S,10R,13S,14S,15S)-hexacyclo[7.5.1.02,5.03,13.06,15.010,14]pentadec-11-ene-4,8-dione |
| SMILES | O=C1[C@H]2[C@H]3C=C[C@H]4[C@@H]5C(=O)C[C@H]6[C@H]1[C@H]2[C@H]([C@H]34)[C@H]65 |
| InChI | InChI=1S/C15H14O2/c16-7-3-6-10-9(7)4-1-2-5-8(4)13(10)14-11(5)15(17)12(6)14/h1-2,4-6,8-14H,3H2/t4-,5+,6-,8+,9-,10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | BCUZMZGSYPKKDL-IJISSYNZSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|