C12H12O2 — CID 14639363
pentacyclo[5.5.0.02,6.03,10.05,9]dodecane-8,12-dione (PubChem CID 14639363) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is pentacyclo[5.5.0.02,6.03,10.05,9]dodecane-8,12-dione.
| Compound Name | pentacyclo[5.5.0.02,6.03,10.05,9]dodecane-8,12-dione |
|---|---|
| PubChem CID | 14639363 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | pentacyclo[5.5.0.02,6.03,10.05,9]dodecane-8,12-dione |
| SMILES | O=C1CC2C3CC4C2C(=O)C2C1C3C42 |
| InChI | InChI=1S/C12H12O2/c13-6-2-4-3-1-5-7(4)12(14)11-9(5)8(3)10(6)11/h3-5,7-11H,1-2H2 |
| InChIKey | WHQMJAPMRAQQEW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |