C10H10OS — CID 124785133
(1R,2S,3S,5R,6R,7S,9S,10S)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-one (PubChem CID 124785133) has the molecular formula C10H10OS and a molecular weight of 178.26 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,7S,9S,10S)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-one.
| Compound Name | (1R,2S,3S,5R,6R,7S,9S,10S)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-one |
|---|---|
| PubChem CID | 124785133 |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (1R,2S,3S,5R,6R,7S,9S,10S)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-one |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]4[C@@H]2S[C@@H]2[C@@H]1[C@@H]3[C@H]42 |
| InChI | InChI=1S/C10H10OS/c11-8-6-2-1-3-5-4(2)7(8)10(5)12-9(3)6/h2-7,9-10H,1H2/t2-,3+,4-,5-,6-,7+,9-,10-/m0/s1 |
| InChIKey | KBDSFBQJRJQXSF-LSICXYRUSA-N |
| XLogP | 1.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |