C11H12O — CID 124710584
(1S,2S,3R,5R,6R,7R,9R,10R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one (PubChem CID 124710584) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (1S,2S,3R,5R,6R,7R,9R,10R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one.
| Compound Name | (1S,2S,3R,5R,6R,7R,9R,10R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
|---|---|
| PubChem CID | 124710584 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1S,2S,3R,5R,6R,7R,9R,10R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
| SMILES | O=C1[C@@H]2[C@@H]3C[C@@H]4[C@@H]1[C@@H]1[C@H]2C[C@H]3[C@@H]41 |
| InChI | InChI=1S/C11H12O/c12-11-8-4-2-5-7-3(4)1-6(8)9(7)10(5)11/h3-10H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10-/m1/s1 |
| InChIKey | XGWUKTZSTPLHEO-YNCSKHHMSA-N |
| XLogP | 1.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |