C11H10O2 — CID 124710529
(1S,2S,3R,5S,6S,7S,9R,10S)-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione (PubChem CID 124710529) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1S,2S,3R,5S,6S,7S,9R,10S)-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione.
| Compound Name | (1S,2S,3R,5S,6S,7S,9R,10S)-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
|---|---|
| PubChem CID | 124710529 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (1S,2S,3R,5S,6S,7S,9R,10S)-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]4[C@@H]2C(=O)[C@@H]2[C@@H]1[C@@H]3[C@H]42 |
| InChI | InChI=1S/C11H10O2/c12-10-6-2-1-3-5-4(2)8(10)9(5)11(13)7(3)6/h2-9H,1H2/t2-,3+,4-,5-,6+,7-,8-,9-/m0/s1 |
| InChIKey | WTUFOKOJVXNYTJ-JLOFKGRESA-N |
| XLogP | 0.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |