C19H27NO — CID 10731882
(1R,2S,3S,5R,6R,7R,9S,10R)-11-octyliminopentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one (PubChem CID 10731882) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,7R,9S,10R)-11-octyliminopentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one.
| Compound Name | (1R,2S,3S,5R,6R,7R,9S,10R)-11-octyliminopentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
|---|---|
| PubChem CID | 10731882 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (1R,2S,3S,5R,6R,7R,9S,10R)-11-octyliminopentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
| SMILES | CCCCCCCC/N=C1/[C@@H]2[C@H]3C[C@H]4[C@@H]2C(=O)[C@H]2[C@H]1[C@@H]3[C@@H]42 |
| InChI | InChI=1S/C19H27NO/c1-2-3-4-5-6-7-8-20-18-14-10-9-11-13-12(10)16(18)17(13)19(21)15(11)14/h10-17H,2-9H2,1H3/b20-18-/t10-,11+,12-,13+,14+,15-,16+,17+/m0/s1 |
| InChIKey | KXHJINCELTVBSQ-OXLGJCGPSA-N |
| XLogP | 3.74 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|