C8H14N2O2 — CID 136954888
2-pentylimino-1,3-oxazolidin-4-one (PubChem CID 136954888) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-pentylimino-1,3-oxazolidin-4-one.
| Compound Name | 2-pentylimino-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 136954888 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-pentylimino-1,3-oxazolidin-4-one |
| SMILES | CCCCC/N=C1/NC(=O)CO1 |
| InChI | InChI=1S/C8H14N2O2/c1-2-3-4-5-9-8-10-7(11)6-12-8/h2-6H2,1H3,(H,9,10,11) |
| InChIKey | ABQZSRRPBHMDIY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|