C10H22N6 — CID 163513706
4-N,6-N-dibutyl-1,2,3,5-tetrazinane-4,6-diimine (PubChem CID 163513706) has the molecular formula C10H22N6 and a molecular weight of 226.33 g/mol. Its IUPAC name is 4-N,6-N-dibutyl-1,2,3,5-tetrazinane-4,6-diimine.
| Compound Name | 4-N,6-N-dibutyl-1,2,3,5-tetrazinane-4,6-diimine |
|---|---|
| PubChem CID | 163513706 |
| Molecular Formula | C10H22N6 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 4-N,6-N-dibutyl-1,2,3,5-tetrazinane-4,6-diimine |
| SMILES | CCCC/N=C1\NNN/C(=N\CCCC)N1 |
| InChI | InChI=1S/C10H22N6/c1-3-5-7-11-9-13-10(15-16-14-9)12-8-6-4-2/h16H,3-8H2,1-2H3,(H3,11,12,13,14,15) |
| InChIKey | YIVKGFDHEJERSD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|