C11H13Cl2N3O2S — CID 136924310
N-butyl-6,8-dichloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 136924310) has the molecular formula C11H13Cl2N3O2S and a molecular weight of 322.22 g/mol. Its IUPAC name is N-butyl-6,8-dichloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-butyl-6,8-dichloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 136924310 |
| Molecular Formula | C11H13Cl2N3O2S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-butyl-6,8-dichloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCCC/N=C1\Nc2cc(Cl)cc(Cl)c2S(=O)(=O)N1 |
| InChI | InChI=1S/C11H13Cl2N3O2S/c1-2-3-4-14-11-15-9-6-7(12)5-8(13)10(9)19(17,18)16-11/h5-6H,2-4H2,1H3,(H2,14,15,16) |
| InChIKey | YMWSQKRSUOYTDG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|