C9H12ClN3O2S2 — CID 135482125
N-butyl-6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-imine (PubChem CID 135482125) has the molecular formula C9H12ClN3O2S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is N-butyl-6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-imine.
| Compound Name | N-butyl-6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-imine |
|---|---|
| PubChem CID | 135482125 |
| Molecular Formula | C9H12ClN3O2S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-butyl-6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-imine |
| SMILES | CCCC/N=C1\Nc2cc(Cl)sc2S(=O)(=O)N1 |
| InChI | InChI=1S/C9H12ClN3O2S2/c1-2-3-4-11-9-12-6-5-7(10)16-8(6)17(14,15)13-9/h5H,2-4H2,1H3,(H2,11,12,13) |
| InChIKey | XCEHYAXUGPYFLD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|