C13H20N4O2S — CID 141026574
3-hexylimino-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-amine (PubChem CID 141026574) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 3-hexylimino-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-amine.
| Compound Name | 3-hexylimino-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-amine |
|---|---|
| PubChem CID | 141026574 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-hexylimino-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-amine |
| SMILES | CCCCCC/N=C1\Nc2cc(N)ccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C13H20N4O2S/c1-2-3-4-5-8-15-13-16-11-9-10(14)6-7-12(11)20(18,19)17-13/h6-7,9H,2-5,8,14H2,1H3,(H2,15,16,17) |
| InChIKey | SCNDZHUIGCHMJS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|