C15H23N3O2S — CID 136924276
N,7-dibutyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 136924276) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is N,7-dibutyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N,7-dibutyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 136924276 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N,7-dibutyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCCC/N=C1\Nc2ccc(CCCC)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C15H23N3O2S/c1-3-5-7-12-8-9-13-14(11-12)21(19,20)18-15(17-13)16-10-6-4-2/h8-9,11H,3-7,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | LWXBUKZBNSFQKK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|