C11H14N2O4S — CID 82213874
7-butoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 82213874) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 7-butoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 7-butoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 82213874 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 7-butoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CCCCOc1ccc2c(c1)S(=O)(=O)NC(=O)N2 |
| InChI | InChI=1S/C11H14N2O4S/c1-2-3-6-17-8-4-5-9-10(7-8)18(15,16)13-11(14)12-9/h4-5,7H,2-3,6H2,1H3,(H2,12,13,14) |
| InChIKey | YZERSIQWKXHBQZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|