C11H14N2O2 — CID 70661188
6-butoxy-1,2-dihydroindazol-3-one (PubChem CID 70661188) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-butoxy-1,2-dihydroindazol-3-one.
| Compound Name | 6-butoxy-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 70661188 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-butoxy-1,2-dihydroindazol-3-one |
| SMILES | CCCCOc1ccc2c(=O)[nH][nH]c2c1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-3-6-15-8-4-5-9-10(7-8)12-13-11(9)14/h4-5,7H,2-3,6H2,1H3,(H2,12,13,14) |
| InChIKey | HMVYFADLQONRKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|