C19H25NO4 — CID 139716963
7-butoxy-4-methoxy-3-(3-methylbut-2-enoxy)-1H-quinolin-2-one (PubChem CID 139716963) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 7-butoxy-4-methoxy-3-(3-methylbut-2-enoxy)-1H-quinolin-2-one.
| Compound Name | 7-butoxy-4-methoxy-3-(3-methylbut-2-enoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139716963 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 7-butoxy-4-methoxy-3-(3-methylbut-2-enoxy)-1H-quinolin-2-one |
| SMILES | CCCCOc1ccc2c(OC)c(OCC=C(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H25NO4/c1-5-6-10-23-14-7-8-15-16(12-14)20-19(21)18(17(15)22-4)24-11-9-13(2)3/h7-9,12H,5-6,10-11H2,1-4H3,(H,20,21) |
| InChIKey | JKAPFKRXHDTJGJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|