C31H47N3O3 — CID 57439687
3,6-bis[3-(dipropylamino)propoxy]-10H-acridin-9-one (PubChem CID 57439687) has the molecular formula C31H47N3O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is 3,6-bis[3-(dipropylamino)propoxy]-10H-acridin-9-one.
| Compound Name | 3,6-bis[3-(dipropylamino)propoxy]-10H-acridin-9-one |
|---|---|
| PubChem CID | 57439687 |
| Molecular Formula | C31H47N3O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.36 |
| IUPAC Name | 3,6-bis[3-(dipropylamino)propoxy]-10H-acridin-9-one |
| SMILES | CCCN(CCC)CCCOc1ccc2c(=O)c3ccc(OCCCN(CCC)CCC)cc3[nH]c2c1 |
| InChI | InChI=1S/C31H47N3O3/c1-5-15-33(16-6-2)19-9-21-36-25-11-13-27-29(23-25)32-30-24-26(12-14-28(30)31(27)35)37-22-10-20-34(17-7-3)18-8-4/h11-14,23-24H,5-10,15-22H2,1-4H3,(H,32,35) |
| InChIKey | TWSGXTFMCROVMB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|