C29H42N2O3S — CID 57439634
3,6-bis[2-(dipropylamino)ethoxy]thioxanthen-9-one (PubChem CID 57439634) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is 3,6-bis[2-(dipropylamino)ethoxy]thioxanthen-9-one.
| Compound Name | 3,6-bis[2-(dipropylamino)ethoxy]thioxanthen-9-one |
|---|---|
| PubChem CID | 57439634 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 3,6-bis[2-(dipropylamino)ethoxy]thioxanthen-9-one |
| SMILES | CCCN(CCC)CCOc1ccc2c(=O)c3ccc(OCCN(CCC)CCC)cc3sc2c1 |
| InChI | InChI=1S/C29H42N2O3S/c1-5-13-30(14-6-2)17-19-33-23-9-11-25-27(21-23)35-28-22-24(10-12-26(28)29(25)32)34-20-18-31(15-7-3)16-8-4/h9-12,21-22H,5-8,13-20H2,1-4H3 |
| InChIKey | UHRLFLRKZLEDAX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|