C21H27N3O3 — CID 57439669
2,6-bis[3-(methylamino)propoxy]-10H-acridin-9-one (PubChem CID 57439669) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2,6-bis[3-(methylamino)propoxy]-10H-acridin-9-one.
| Compound Name | 2,6-bis[3-(methylamino)propoxy]-10H-acridin-9-one |
|---|---|
| PubChem CID | 57439669 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2,6-bis[3-(methylamino)propoxy]-10H-acridin-9-one |
| SMILES | CNCCCOc1ccc2c(=O)c3cc(OCCCNC)ccc3[nH]c2c1 |
| InChI | InChI=1S/C21H27N3O3/c1-22-9-3-11-26-15-6-8-19-18(13-15)21(25)17-7-5-16(14-20(17)24-19)27-12-4-10-23-2/h5-8,13-14,22-23H,3-4,9-12H2,1-2H3,(H,24,25) |
| InChIKey | PJTZELZAUIXNTC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|