C30H36N2O8 — CID 10530739
3-butyl-6-[4-[(3-butyl-3-hydroxy-2,4-dioxo-1H-quinolin-6-yl)oxy]butoxy]-3-hydroxy-1H-quinoline-2,4-dione (PubChem CID 10530739) has the molecular formula C30H36N2O8 and a molecular weight of 552.62 g/mol. Its IUPAC name is 3-butyl-6-[4-[(3-butyl-3-hydroxy-2,4-dioxo-1H-quinolin-6-yl)oxy]butoxy]-3-hydroxy-1H-quinoline-2,4-dione.
| Compound Name | 3-butyl-6-[4-[(3-butyl-3-hydroxy-2,4-dioxo-1H-quinolin-6-yl)oxy]butoxy]-3-hydroxy-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 10530739 |
| Molecular Formula | C30H36N2O8 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 3-butyl-6-[4-[(3-butyl-3-hydroxy-2,4-dioxo-1H-quinolin-6-yl)oxy]butoxy]-3-hydroxy-1H-quinoline-2,4-dione |
| SMILES | CCCCC1(O)C(=O)Nc2ccc(OCCCCOc3ccc4c(c3)C(=O)C(O)(CCCC)C(=O)N4)cc2C1=O |
| InChI | InChI=1S/C30H36N2O8/c1-3-5-13-29(37)25(33)21-17-19(9-11-23(21)31-27(29)35)39-15-7-8-16-40-20-10-12-24-22(18-20)26(34)30(38,14-6-4-2)28(36)32-24/h9-12,17-18,37-38H,3-8,13-16H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | UQMDVTHIWMZSHP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|