C25H41NO — CID 139634173
6-butoxy-2,2,4-tributyl-1H-quinoline (PubChem CID 139634173) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 6-butoxy-2,2,4-tributyl-1H-quinoline.
| Compound Name | 6-butoxy-2,2,4-tributyl-1H-quinoline |
|---|---|
| PubChem CID | 139634173 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 6-butoxy-2,2,4-tributyl-1H-quinoline |
| SMILES | CCCCOc1ccc2c(c1)C(CCCC)=CC(CCCC)(CCCC)N2 |
| InChI | InChI=1S/C25H41NO/c1-5-9-13-21-20-25(16-10-6-2,17-11-7-3)26-24-15-14-22(19-23(21)24)27-18-12-8-4/h14-15,19-20,26H,5-13,16-18H2,1-4H3 |
| InChIKey | ANVYPEMFUJHIJQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|