About 6-butoxy-2,2,4-tributyl-1H-quinoline
6-butoxy-2,2,4-tributyl-1H-quinoline (PubChem CID 139634173) has the molecular formula C25H41NO
and a molecular weight of 371.61 g/mol. Its IUPAC name is 6-butoxy-2,2,4-tributyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-butoxy-2,2,4-tributyl-1H-quinoline |
| PubChem CID | 139634173 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 6-butoxy-2,2,4-tributyl-1H-quinoline |
| SMILES | CCCCOc1ccc2c(c1)C(CCCC)=CC(CCCC)(CCCC)N2 |
| InChI | InChI=1S/C25H41NO/c1-5-9-13-21-20-25(16-10-6-2,17-11-7-3)26-24-15-14-22(19-23(21)24)27-18-12-8-4/h14-15,19-20,26H,5-13,16-18H2,1-4H3 |
| InChIKey | ANVYPEMFUJHIJQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxy-2,2,4-tributyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxy-2,2,4-tributyl-1H-quinoline?
The IUPAC name of 6-butoxy-2,2,4-tributyl-1H-quinoline (CID 139634173) is 6-butoxy-2,2,4-tributyl-1H-quinoline.
What is the SMILES notation for 6-butoxy-2,2,4-tributyl-1H-quinoline?
The canonical SMILES for 6-butoxy-2,2,4-tributyl-1H-quinoline is CCCCOc1ccc2c(c1)C(CCCC)=CC(CCCC)(CCCC)N2.
What is the InChIKey of 6-butoxy-2,2,4-tributyl-1H-quinoline?
The InChIKey is ANVYPEMFUJHIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41NO/c1-5-9-13-21-20-25(16-10-6-2,17-11-7-3)26-24-15-14-22(19-23(21)24)27-18-12-8-4/h14-15,19-20,26H,5-13,16-18H2,1-4H3.
What are the key properties of 6-butoxy-2,2,4-tributyl-1H-quinoline?
6-butoxy-2,2,4-tributyl-1H-quinoline has a molecular weight of 371.61 g/mol, XLogP of 7.98, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-2,2,4-tributyl-1H-quinoline is sourced from PubChem (CID 139634173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).