About 5-butoxy-2,2-dimethoxyindene-1,3-dione
5-butoxy-2,2-dimethoxyindene-1,3-dione (PubChem CID 100996354) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-butoxy-2,2-dimethoxyindene-1,3-dione.
Molecular Properties
| Compound Name | 5-butoxy-2,2-dimethoxyindene-1,3-dione |
| PubChem CID | 100996354 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-butoxy-2,2-dimethoxyindene-1,3-dione |
| SMILES | CCCCOc1ccc2c(c1)C(=O)C(OC)(OC)C2=O |
| InChI | InChI=1S/C15H18O5/c1-4-5-8-20-10-6-7-11-12(9-10)14(17)15(18-2,19-3)13(11)16/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | AEJWLQQZQRTGLG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-2,2-dimethoxyindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-2,2-dimethoxyindene-1,3-dione?
The IUPAC name of 5-butoxy-2,2-dimethoxyindene-1,3-dione (CID 100996354) is 5-butoxy-2,2-dimethoxyindene-1,3-dione.
What is the SMILES notation for 5-butoxy-2,2-dimethoxyindene-1,3-dione?
The canonical SMILES for 5-butoxy-2,2-dimethoxyindene-1,3-dione is CCCCOc1ccc2c(c1)C(=O)C(OC)(OC)C2=O.
What is the InChIKey of 5-butoxy-2,2-dimethoxyindene-1,3-dione?
The InChIKey is AEJWLQQZQRTGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O5/c1-4-5-8-20-10-6-7-11-12(9-10)14(17)15(18-2,19-3)13(11)16/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 5-butoxy-2,2-dimethoxyindene-1,3-dione?
5-butoxy-2,2-dimethoxyindene-1,3-dione has a molecular weight of 278.30 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-2,2-dimethoxyindene-1,3-dione is sourced from PubChem (CID 100996354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).