C15H18O5 — CID 100996354
5-butoxy-2,2-dimethoxyindene-1,3-dione (PubChem CID 100996354) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-butoxy-2,2-dimethoxyindene-1,3-dione.
| Compound Name | 5-butoxy-2,2-dimethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 100996354 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-butoxy-2,2-dimethoxyindene-1,3-dione |
| SMILES | CCCCOc1ccc2c(c1)C(=O)C(OC)(OC)C2=O |
| InChI | InChI=1S/C15H18O5/c1-4-5-8-20-10-6-7-11-12(9-10)14(17)15(18-2,19-3)13(11)16/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | AEJWLQQZQRTGLG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|