C15H17NO4 — CID 82062800
(4Z)-6-butoxy-4-(methoxymethylidene)isoquinoline-1,3-dione (PubChem CID 82062800) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (4Z)-6-butoxy-4-(methoxymethylidene)isoquinoline-1,3-dione.
| Compound Name | (4Z)-6-butoxy-4-(methoxymethylidene)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 82062800 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (4Z)-6-butoxy-4-(methoxymethylidene)isoquinoline-1,3-dione |
| SMILES | CCCCOc1ccc2c(c1)/C(=C/OC)C(=O)NC2=O |
| InChI | InChI=1S/C15H17NO4/c1-3-4-7-20-10-5-6-11-12(8-10)13(9-19-2)15(18)16-14(11)17/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17,18)/b13-9- |
| InChIKey | UPEKUNHMLDSMNA-LCYFTJDESA-N |
| XLogP | 2.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|