About 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one
7-butoxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 145310441) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 145310441 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CCCCOc1ccc2c(c1)C(=O)NCC2 |
| InChI | InChI=1S/C13H17NO2/c1-2-3-8-16-11-5-4-10-6-7-14-13(15)12(10)9-11/h4-5,9H,2-3,6-8H2,1H3,(H,14,15) |
| InChIKey | UXVJMGYNGNNCIJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one (CID 145310441) is 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one is CCCCOc1ccc2c(c1)C(=O)NCC2.
What is the InChIKey of 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is UXVJMGYNGNNCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-3-8-16-11-5-4-10-6-7-14-13(15)12(10)9-11/h4-5,9H,2-3,6-8H2,1H3,(H,14,15).
What are the key properties of 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one?
7-butoxy-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 219.28 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butoxy-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 145310441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).