C20H23N3O3 — CID 90524964
1-(4-butoxyphenyl)-3-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)urea (PubChem CID 90524964) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)urea.
| Compound Name | 1-(4-butoxyphenyl)-3-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)urea |
|---|---|
| PubChem CID | 90524964 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)urea |
| SMILES | CCCCOc1ccc(NC(=O)Nc2ccc3c(c2)C(=O)NCC3)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-3-12-26-17-8-6-15(7-9-17)22-20(25)23-16-5-4-14-10-11-21-19(24)18(14)13-16/h4-9,13H,2-3,10-12H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | IAPPQDJIDGHMAN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|