C14H20N2O3 — CID 21470870
5-butoxy-3,3-dimethoxyisoindol-1-amine (PubChem CID 21470870) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-butoxy-3,3-dimethoxyisoindol-1-amine.
| Compound Name | 5-butoxy-3,3-dimethoxyisoindol-1-amine |
|---|---|
| PubChem CID | 21470870 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-butoxy-3,3-dimethoxyisoindol-1-amine |
| SMILES | CCCCOc1ccc2c(c1)C(OC)(OC)N=C2N |
| InChI | InChI=1S/C14H20N2O3/c1-4-5-8-19-10-6-7-11-12(9-10)14(17-2,18-3)16-13(11)15/h6-7,9H,4-5,8H2,1-3H3,(H2,15,16) |
| InChIKey | YDNYYKJUHSSRNK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|