C18H26N2O3 — CID 139699022
6'-octoxyspiro[1,3-dioxolane-2,3'-isoindole]-1'-amine (PubChem CID 139699022) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 6'-octoxyspiro[1,3-dioxolane-2,3'-isoindole]-1'-amine.
| Compound Name | 6'-octoxyspiro[1,3-dioxolane-2,3'-isoindole]-1'-amine |
|---|---|
| PubChem CID | 139699022 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6'-octoxyspiro[1,3-dioxolane-2,3'-isoindole]-1'-amine |
| SMILES | CCCCCCCCOc1ccc2c(c1)C(N)=NC21OCCO1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-5-6-7-10-21-14-8-9-16-15(13-14)17(19)20-18(16)22-11-12-23-18/h8-9,13H,2-7,10-12H2,1H3,(H2,19,20) |
| InChIKey | VQBJANZHQKRZKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|