C15H23NO3 — CID 58428365
[2-(4-pentoxyphenyl)-1,3-dioxolan-2-yl]methanamine (PubChem CID 58428365) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [2-(4-pentoxyphenyl)-1,3-dioxolan-2-yl]methanamine.
| Compound Name | [2-(4-pentoxyphenyl)-1,3-dioxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 58428365 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [2-(4-pentoxyphenyl)-1,3-dioxolan-2-yl]methanamine |
| SMILES | CCCCCOc1ccc(C2(CN)OCCO2)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-2-3-4-9-17-14-7-5-13(6-8-14)15(12-16)18-10-11-19-15/h5-8H,2-4,9-12,16H2,1H3 |
| InChIKey | USOGZMYGVAAGKM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|