C12H16O3 — CID 82126602
2-(4-ethoxyphenyl)-2-methyl-1,3-dioxolane (PubChem CID 82126602) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(4-ethoxyphenyl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 82126602 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)-2-methyl-1,3-dioxolane |
| SMILES | CCOc1ccc(C2(C)OCCO2)cc1 |
| InChI | InChI=1S/C12H16O3/c1-3-13-11-6-4-10(5-7-11)12(2)14-8-9-15-12/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | BVQQXJZRQQCELG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |