C16H24O — CID 155310542
1-(1,2-dimethylcyclopropyl)-4-pentoxybenzene (PubChem CID 155310542) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(1,2-dimethylcyclopropyl)-4-pentoxybenzene.
| Compound Name | 1-(1,2-dimethylcyclopropyl)-4-pentoxybenzene |
|---|---|
| PubChem CID | 155310542 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(1,2-dimethylcyclopropyl)-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(C2(C)CC2C)cc1 |
| InChI | InChI=1S/C16H24O/c1-4-5-6-11-17-15-9-7-14(8-10-15)16(3)12-13(16)2/h7-10,13H,4-6,11-12H2,1-3H3 |
| InChIKey | UIOGHGXCKPKGLW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|