C16H23NO3 — CID 170120450
3-(4-butoxyphenyl)-N,N-dimethyloxetane-3-carboxamide (PubChem CID 170120450) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-N,N-dimethyloxetane-3-carboxamide.
| Compound Name | 3-(4-butoxyphenyl)-N,N-dimethyloxetane-3-carboxamide |
|---|---|
| PubChem CID | 170120450 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(4-butoxyphenyl)-N,N-dimethyloxetane-3-carboxamide |
| SMILES | CCCCOc1ccc(C2(C(=O)N(C)C)COC2)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-4-5-10-20-14-8-6-13(7-9-14)16(11-19-12-16)15(18)17(2)3/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | CPVWLUQPQNVLTG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|