C13H19NOS — CID 175413654
4-butoxy-N,N-dimethylbenzenecarbothioamide (PubChem CID 175413654) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 4-butoxy-N,N-dimethylbenzenecarbothioamide.
| Compound Name | 4-butoxy-N,N-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 175413654 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-butoxy-N,N-dimethylbenzenecarbothioamide |
| SMILES | CCCCOc1ccc(C(=S)N(C)C)cc1 |
| InChI | InChI=1S/C13H19NOS/c1-4-5-10-15-12-8-6-11(7-9-12)13(16)14(2)3/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | LKLIAFFPVMHBDV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|