C14H17Cl3O — CID 71373306
1-butoxy-4-(4,4,4-trichlorobut-1-en-2-yl)benzene (PubChem CID 71373306) has the molecular formula C14H17Cl3O and a molecular weight of 307.65 g/mol. Its IUPAC name is 1-butoxy-4-(4,4,4-trichlorobut-1-en-2-yl)benzene.
| Compound Name | 1-butoxy-4-(4,4,4-trichlorobut-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 71373306 |
| Molecular Formula | C14H17Cl3O |
| Molecular Weight | 307.65 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-butoxy-4-(4,4,4-trichlorobut-1-en-2-yl)benzene |
| SMILES | C=C(CC(Cl)(Cl)Cl)c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C14H17Cl3O/c1-3-4-9-18-13-7-5-12(6-8-13)11(2)10-14(15,16)17/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | DKBKEVKUKHMDPI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|