C15H18N2O5S — CID 21162197
7-butoxy-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 21162197) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 7-butoxy-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 7-butoxy-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 21162197 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 7-butoxy-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCCCOc1ccc2c(c1)S(=O)(=O)CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C15H18N2O5S/c1-2-3-7-22-10-4-5-11-12(9-10)23(20,21)8-6-15(11)13(18)16-14(19)17-15/h4-5,9H,2-3,6-8H2,1H3,(H2,16,17,18,19) |
| InChIKey | LIENQPMWTKQUKG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|