C14H20N2O3S2 — CID 82213688
7-ethoxy-3-pentylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 82213688) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 7-ethoxy-3-pentylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 7-ethoxy-3-pentylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 82213688 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 7-ethoxy-3-pentylsulfanyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCCCCSC1=NS(=O)(=O)c2cc(OCC)ccc2N1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-3-5-6-9-20-14-15-12-8-7-11(19-4-2)10-13(12)21(17,18)16-14/h7-8,10H,3-6,9H2,1-2H3,(H,15,16) |
| InChIKey | HYAQCEPRALQLPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|