C12H16N2O2S — CID 13111638
3-pentyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 13111638) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-pentyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-pentyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 13111638 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-pentyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCCCCC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C12H16N2O2S/c1-2-3-4-9-12-13-10-7-5-6-8-11(10)17(15,16)14-12/h5-8H,2-4,9H2,1H3,(H,13,14) |
| InChIKey | JVMPQYRPGCRZQH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|