C15H21N3O4S — CID 15996356
4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-(3-methoxypropyl)butanamide (PubChem CID 15996356) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-(3-methoxypropyl)butanamide.
| Compound Name | 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 15996356 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-(3-methoxypropyl)butanamide |
| SMILES | COCCCNC(=O)CCCC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C15H21N3O4S/c1-22-11-5-10-16-15(19)9-4-8-14-17-12-6-2-3-7-13(12)23(20,21)18-14/h2-3,6-7H,4-5,8-11H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | RMUWJHSXPXIFGW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|