C21H25N3O3S — CID 42585078
(3S)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methyl-N-(3-phenylpropyl)butanamide (PubChem CID 42585078) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is (3S)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methyl-N-(3-phenylpropyl)butanamide.
| Compound Name | (3S)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methyl-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 42585078 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (3S)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methyl-N-(3-phenylpropyl)butanamide |
| SMILES | C[C@H](CC(=O)NCCCc1ccccc1)CC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C21H25N3O3S/c1-16(15-21(25)22-13-7-10-17-8-3-2-4-9-17)14-20-23-18-11-5-6-12-19(18)28(26,27)24-20/h2-6,8-9,11-12,16H,7,10,13-15H2,1H3,(H,22,25)(H,23,24)/t16-/m0/s1 |
| InChIKey | NZBKDEIAABKOQL-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|