C16H22N4O4S — CID 22588942
N-(2-acetamidoethyl)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methylbutanamide (PubChem CID 22588942) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methylbutanamide.
| Compound Name | N-(2-acetamidoethyl)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 22588942 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(2-acetamidoethyl)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-methylbutanamide |
| SMILES | CC(=O)NCCNC(=O)CC(C)CC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C16H22N4O4S/c1-11(10-16(22)18-8-7-17-12(2)21)9-15-19-13-5-3-4-6-14(13)25(23,24)20-15/h3-6,11H,7-10H2,1-2H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | NVGWJYWENAGHKR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|