C12H15ClN2O2S — CID 119090237
7-chloro-3-pentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 119090237) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 7-chloro-3-pentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 7-chloro-3-pentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 119090237 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 7-chloro-3-pentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCCCCC1=NS(=O)(=O)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C12H15ClN2O2S/c1-2-3-4-5-12-14-10-7-6-9(13)8-11(10)18(16,17)15-12/h6-8H,2-5H2,1H3,(H,14,15) |
| InChIKey | IHTYHROZBCBCLR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|