C10H11ClN2O3S2 — CID 94948869
3-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]propan-1-ol (PubChem CID 94948869) has the molecular formula C10H11ClN2O3S2 and a molecular weight of 306.80 g/mol. Its IUPAC name is 3-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]propan-1-ol.
| Compound Name | 3-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 94948869 |
| Molecular Formula | C10H11ClN2O3S2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 3-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]propan-1-ol |
| SMILES | O=S1(=O)N=C(SCCCO)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H11ClN2O3S2/c11-7-2-3-8-9(6-7)18(15,16)13-10(12-8)17-5-1-4-14/h2-3,6,14H,1,4-5H2,(H,12,13) |
| InChIKey | NRAHQZBVSOPIAC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|