C22H22N2O4S — CID 134911897
3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-hexylchromen-2-one (PubChem CID 134911897) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-hexylchromen-2-one.
| Compound Name | 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-hexylchromen-2-one |
|---|---|
| PubChem CID | 134911897 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-hexylchromen-2-one |
| SMILES | CCCCCCc1ccc2oc(=O)c(C3=NS(=O)(=O)c4ccccc4N3)cc2c1 |
| InChI | InChI=1S/C22H22N2O4S/c1-2-3-4-5-8-15-11-12-19-16(13-15)14-17(22(25)28-19)21-23-18-9-6-7-10-20(18)29(26,27)24-21/h6-7,9-14H,2-5,8H2,1H3,(H,23,24) |
| InChIKey | FZVYWQXLWQORIH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|