C22H20N2O5S — CID 132590900
butyl 4-[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)furan-2-yl]benzoate (PubChem CID 132590900) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is butyl 4-[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 132590900 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | butyl 4-[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(C3=NS(=O)(=O)c4ccccc4N3)o2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-2-3-14-28-22(25)16-10-8-15(9-11-16)18-12-13-19(29-18)21-23-17-6-4-5-7-20(17)30(26,27)24-21/h4-13H,2-3,14H2,1H3,(H,23,24) |
| InChIKey | UVIZXERWTMKWDQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|