C23H23N3O4 — CID 126069847
butyl 4-[5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 126069847) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is butyl 4-[5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126069847 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | butyl 4-[5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)Nc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-2-3-15-29-22(27)18-11-9-17(10-12-18)21-14-13-20(30-21)16-24-26-23(28)25-19-7-5-4-6-8-19/h4-14,16H,2-3,15H2,1H3,(H2,25,26,28)/b24-16- |
| InChIKey | LHYOIZUAAHEDCM-JLPGSUDCSA-N |
| XLogP | 5.06 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|